C13H16N4O2 — CID 112579471
ethyl 3-amino-2-(3,5-dimethyl-1,2,4-triazol-1-yl)benzoate (PubChem CID 112579471) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is ethyl 3-amino-2-(3,5-dimethyl-1,2,4-triazol-1-yl)benzoate.
| Compound Name | ethyl 3-amino-2-(3,5-dimethyl-1,2,4-triazol-1-yl)benzoate |
|---|---|
| PubChem CID | 112579471 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | ethyl 3-amino-2-(3,5-dimethyl-1,2,4-triazol-1-yl)benzoate |
| SMILES | CCOC(=O)c1cccc(N)c1-n1nc(C)nc1C |
| InChI | InChI=1S/C13H16N4O2/c1-4-19-13(18)10-6-5-7-11(14)12(10)17-9(3)15-8(2)16-17/h5-7H,4,14H2,1-3H3 |
| InChIKey | FKOQACJXLIYXKE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|