C19H14F5NO3 — CID 11258053
[(Z)-[2-methoxy-1-(2-prop-2-enylphenyl)ethylidene]amino] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 11258053) has the molecular formula C19H14F5NO3 and a molecular weight of 399.32 g/mol. Its IUPAC name is [(Z)-[2-methoxy-1-(2-prop-2-enylphenyl)ethylidene]amino] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [(Z)-[2-methoxy-1-(2-prop-2-enylphenyl)ethylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 11258053 |
| Molecular Formula | C19H14F5NO3 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | [(Z)-[2-methoxy-1-(2-prop-2-enylphenyl)ethylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | C=CCc1ccccc1/C(COC)=N/OC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H14F5NO3/c1-3-6-10-7-4-5-8-11(10)12(9-27-2)25-28-19(26)13-14(20)16(22)18(24)17(23)15(13)21/h3-5,7-8H,1,6,9H2,2H3/b25-12+ |
| InChIKey | DMNWHLJTWNUNDD-BRJLIKDPSA-N |
| XLogP | 4.32 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|