C10H14N4O3 — CID 112580635
N',N'-dimethyl-2-(methylamino)-3-nitrobenzohydrazide (PubChem CID 112580635) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is N',N'-dimethyl-2-(methylamino)-3-nitrobenzohydrazide.
| Compound Name | N',N'-dimethyl-2-(methylamino)-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 112580635 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N',N'-dimethyl-2-(methylamino)-3-nitrobenzohydrazide |
| SMILES | CNc1c(C(=O)NN(C)C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N4O3/c1-11-9-7(10(15)12-13(2)3)5-4-6-8(9)14(16)17/h4-6,11H,1-3H3,(H,12,15) |
| InChIKey | WADIQZUPPCYUCK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|