C23H28O6 — CID 11258087
8-O-[(1S,2E,4E,6E)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]nona-2,4,6,8-tetraenyl] 1-O-methyl (E)-oct-2-en-6-ynedioate (PubChem CID 11258087) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is 8-O-[(1S,2E,4E,6E)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]nona-2,4,6,8-tetraenyl] 1-O-methyl (E)-oct-2-en-6-ynedioate.
| Compound Name | 8-O-[(1S,2E,4E,6E)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]nona-2,4,6,8-tetraenyl] 1-O-methyl (E)-oct-2-en-6-ynedioate |
|---|---|
| PubChem CID | 11258087 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 8-O-[(1S,2E,4E,6E)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]nona-2,4,6,8-tetraenyl] 1-O-methyl (E)-oct-2-en-6-ynedioate |
| SMILES | C=C/C=C/C=C/C=C/[C@H](OC(=O)C#CCC/C=C/C(=O)OC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C23H28O6/c1-5-6-7-8-9-12-15-19(20-18-27-23(2,3)29-20)28-22(25)17-14-11-10-13-16-21(24)26-4/h5-9,12-13,15-16,19-20H,1,10-11,18H2,2-4H3/b7-6+,9-8+,15-12+,16-13+/t19-,20+/m0/s1 |
| InChIKey | BGYRIRAZPJVIJJ-UHXUOTHOSA-N |
| XLogP | 3.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|