C22H29NO6 — CID 11258182
(4S,5R)-4-methoxy-3-[(1S,2R,4R)-2-methoxy-7,7-dimethylbicyclo[2.2.1]heptane-1-carbonyl]-5-phenylmethoxy-1,3-oxazolidin-2-one (PubChem CID 11258182) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is (4S,5R)-4-methoxy-3-[(1S,2R,4R)-2-methoxy-7,7-dimethylbicyclo[2.2.1]heptane-1-carbonyl]-5-phenylmethoxy-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-4-methoxy-3-[(1S,2R,4R)-2-methoxy-7,7-dimethylbicyclo[2.2.1]heptane-1-carbonyl]-5-phenylmethoxy-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11258182 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (4S,5R)-4-methoxy-3-[(1S,2R,4R)-2-methoxy-7,7-dimethylbicyclo[2.2.1]heptane-1-carbonyl]-5-phenylmethoxy-1,3-oxazolidin-2-one |
| SMILES | CO[C@H]1[C@H](OCc2ccccc2)OC(=O)N1C(=O)[C@]12CC[C@H](C[C@H]1OC)C2(C)C |
| InChI | InChI=1S/C22H29NO6/c1-21(2)15-10-11-22(21,16(12-15)26-3)19(24)23-17(27-4)18(29-20(23)25)28-13-14-8-6-5-7-9-14/h5-9,15-18H,10-13H2,1-4H3/t15-,16-,17+,18-,22+/m1/s1 |
| InChIKey | WWHXFWSMSBGFKF-JTJFMMGNSA-N |
| XLogP | 3.32 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |