C22H33N3O4 — CID 11258188
(1S,2S,5S)-2-[4-(4-tert-butylphenyl)piperazine-1-carbonyl]-N,5-dihydroxycyclohexane-1-carboxamide (PubChem CID 11258188) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is (1S,2S,5S)-2-[4-(4-tert-butylphenyl)piperazine-1-carbonyl]-N,5-dihydroxycyclohexane-1-carboxamide.
| Compound Name | (1S,2S,5S)-2-[4-(4-tert-butylphenyl)piperazine-1-carbonyl]-N,5-dihydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11258188 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (1S,2S,5S)-2-[4-(4-tert-butylphenyl)piperazine-1-carbonyl]-N,5-dihydroxycyclohexane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(N2CCN(C(=O)[C@H]3CC[C@H](O)C[C@@H]3C(=O)NO)CC2)cc1 |
| InChI | InChI=1S/C22H33N3O4/c1-22(2,3)15-4-6-16(7-5-15)24-10-12-25(13-11-24)21(28)18-9-8-17(26)14-19(18)20(27)23-29/h4-7,17-19,26,29H,8-14H2,1-3H3,(H,23,27)/t17-,18-,19-/m0/s1 |
| InChIKey | VIHJTZJUXNIUIB-FHWLQOOXSA-N |
| XLogP | 1.92 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|