C8H12BrN3O2S — CID 112581934
2-[(6-bromo-2-pyridinyl)methylamino]ethanesulfonamide (PubChem CID 112581934) has the molecular formula C8H12BrN3O2S and a molecular weight of 294.17 g/mol. Its IUPAC name is 2-[(6-bromo-2-pyridinyl)methylamino]ethanesulfonamide.
| Compound Name | 2-[(6-bromo-2-pyridinyl)methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 112581934 |
| Molecular Formula | C8H12BrN3O2S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 2-[(6-bromo-2-pyridinyl)methylamino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNCc1cccc(Br)n1 |
| InChI | InChI=1S/C8H12BrN3O2S/c9-8-3-1-2-7(12-8)6-11-4-5-15(10,13)14/h1-3,11H,4-6H2,(H2,10,13,14) |
| InChIKey | BDPGECXCNIVBGG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|