C13H22BrN3 — CID 112582243
2-N-[(6-bromo-2-pyridinyl)methyl]-1-N,1-N,3-trimethylbutane-1,2-diamine (PubChem CID 112582243) has the molecular formula C13H22BrN3 and a molecular weight of 300.24 g/mol. Its IUPAC name is 2-N-[(6-bromo-2-pyridinyl)methyl]-1-N,1-N,3-trimethylbutane-1,2-diamine.
| Compound Name | 2-N-[(6-bromo-2-pyridinyl)methyl]-1-N,1-N,3-trimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 112582243 |
| Molecular Formula | C13H22BrN3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-N-[(6-bromo-2-pyridinyl)methyl]-1-N,1-N,3-trimethylbutane-1,2-diamine |
| SMILES | CC(C)C(CN(C)C)NCc1cccc(Br)n1 |
| InChI | InChI=1S/C13H22BrN3/c1-10(2)12(9-17(3)4)15-8-11-6-5-7-13(14)16-11/h5-7,10,12,15H,8-9H2,1-4H3 |
| InChIKey | MKUZWFPASWYQAD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|