C12H14BrN3S — CID 112582356
N-[(6-bromo-2-pyridinyl)methyl]-2-(4-methyl-1,3-thiazol-2-yl)ethanamine (PubChem CID 112582356) has the molecular formula C12H14BrN3S and a molecular weight of 312.24 g/mol. Its IUPAC name is N-[(6-bromo-2-pyridinyl)methyl]-2-(4-methyl-1,3-thiazol-2-yl)ethanamine.
| Compound Name | N-[(6-bromo-2-pyridinyl)methyl]-2-(4-methyl-1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 112582356 |
| Molecular Formula | C12H14BrN3S |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | N-[(6-bromo-2-pyridinyl)methyl]-2-(4-methyl-1,3-thiazol-2-yl)ethanamine |
| SMILES | Cc1csc(CCNCc2cccc(Br)n2)n1 |
| InChI | InChI=1S/C12H14BrN3S/c1-9-8-17-12(15-9)5-6-14-7-10-3-2-4-11(13)16-10/h2-4,8,14H,5-7H2,1H3 |
| InChIKey | BEVQJFMUWSNCNS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|