About N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine
N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine (PubChem CID 112582461) has the molecular formula C10H11BrN2O2S
and a molecular weight of 303.18 g/mol. Its IUPAC name is N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine.
Molecular Properties
| Compound Name | N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| PubChem CID | 112582461 |
| Molecular Formula | C10H11BrN2O2S |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| SMILES | O=S1(=O)C=CC(NCc2cccc(Br)n2)C1 |
| InChI | InChI=1S/C10H11BrN2O2S/c11-10-3-1-2-8(13-10)6-12-9-4-5-16(14,15)7-9/h1-5,9,12H,6-7H2 |
| InChIKey | PKXNLRXBFVKBCY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine?
The IUPAC name of N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine (CID 112582461) is N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine.
What is the SMILES notation for N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine?
The canonical SMILES for N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine is O=S1(=O)C=CC(NCc2cccc(Br)n2)C1.
What is the InChIKey of N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine?
The InChIKey is PKXNLRXBFVKBCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2O2S/c11-10-3-1-2-8(13-10)6-12-9-4-5-16(14,15)7-9/h1-5,9,12H,6-7H2.
What are the key properties of N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine?
N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine has a molecular weight of 303.18 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromo-2-pyridinyl)methyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine is sourced from PubChem (CID 112582461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).