C11H11N3O3 — CID 112582742
2-(oxolan-3-yl)-1H-imidazo[4,5-b]pyridine-7-carboxylic acid (PubChem CID 112582742) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 2-(oxolan-3-yl)-1H-imidazo[4,5-b]pyridine-7-carboxylic acid.
| Compound Name | 2-(oxolan-3-yl)-1H-imidazo[4,5-b]pyridine-7-carboxylic acid |
|---|---|
| PubChem CID | 112582742 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-(oxolan-3-yl)-1H-imidazo[4,5-b]pyridine-7-carboxylic acid |
| SMILES | O=C(O)c1ccnc2nc(C3CCOC3)[nH]c12 |
| InChI | InChI=1S/C11H11N3O3/c15-11(16)7-1-3-12-10-8(7)13-9(14-10)6-2-4-17-5-6/h1,3,6H,2,4-5H2,(H,15,16)(H,12,13,14) |
| InChIKey | BSHUZJORIACBIO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |