C20H27NO6S — CID 11258356
diethyl (3aR,6aS)-2-(4-methylphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5,5-dicarboxylate (PubChem CID 11258356) has the molecular formula C20H27NO6S and a molecular weight of 409.50 g/mol. Its IUPAC name is diethyl (3aR,6aS)-2-(4-methylphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5,5-dicarboxylate.
| Compound Name | diethyl (3aR,6aS)-2-(4-methylphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5,5-dicarboxylate |
|---|---|
| PubChem CID | 11258356 |
| Molecular Formula | C20H27NO6S |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | diethyl (3aR,6aS)-2-(4-methylphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H]2CN(S(=O)(=O)c3ccc(C)cc3)C[C@H]2C1 |
| InChI | InChI=1S/C20H27NO6S/c1-4-26-18(22)20(19(23)27-5-2)10-15-12-21(13-16(15)11-20)28(24,25)17-8-6-14(3)7-9-17/h6-9,15-16H,4-5,10-13H2,1-3H3/t15-,16+ |
| InChIKey | IVRDADOXWWYOCZ-IYBDPMFKSA-N |
| XLogP | 2.14 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|