C14H15ClN2S — CID 112585012
1-[5-(2-chlorophenyl)sulfanyl-2-pyridinyl]propan-1-amine (PubChem CID 112585012) has the molecular formula C14H15ClN2S and a molecular weight of 278.81 g/mol. Its IUPAC name is 1-[5-(2-chlorophenyl)sulfanyl-2-pyridinyl]propan-1-amine.
| Compound Name | 1-[5-(2-chlorophenyl)sulfanyl-2-pyridinyl]propan-1-amine |
|---|---|
| PubChem CID | 112585012 |
| Molecular Formula | C14H15ClN2S |
| Molecular Weight | 278.81 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-[5-(2-chlorophenyl)sulfanyl-2-pyridinyl]propan-1-amine |
| SMILES | CCC(N)c1ccc(Sc2ccccc2Cl)cn1 |
| InChI | InChI=1S/C14H15ClN2S/c1-2-12(16)13-8-7-10(9-17-13)18-14-6-4-3-5-11(14)15/h3-9,12H,2,16H2,1H3 |
| InChIKey | TULMNDJAPAXIDS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |