C11H18N2O2S — CID 112585176
3-[[6-(1-aminopropyl)-3-pyridinyl]sulfanyl]propane-1,2-diol (PubChem CID 112585176) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 3-[[6-(1-aminopropyl)-3-pyridinyl]sulfanyl]propane-1,2-diol.
| Compound Name | 3-[[6-(1-aminopropyl)-3-pyridinyl]sulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 112585176 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-[[6-(1-aminopropyl)-3-pyridinyl]sulfanyl]propane-1,2-diol |
| SMILES | CCC(N)c1ccc(SCC(O)CO)cn1 |
| InChI | InChI=1S/C11H18N2O2S/c1-2-10(12)11-4-3-9(5-13-11)16-7-8(15)6-14/h3-5,8,10,14-15H,2,6-7,12H2,1H3 |
| InChIKey | BJGDHGJMOYGSHH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |