C13H22N2O2 — CID 112585320
1-[5-[2-hydroxyethyl(propyl)amino]-2-pyridinyl]propan-1-ol (PubChem CID 112585320) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[5-[2-hydroxyethyl(propyl)amino]-2-pyridinyl]propan-1-ol.
| Compound Name | 1-[5-[2-hydroxyethyl(propyl)amino]-2-pyridinyl]propan-1-ol |
|---|---|
| PubChem CID | 112585320 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-[5-[2-hydroxyethyl(propyl)amino]-2-pyridinyl]propan-1-ol |
| SMILES | CCCN(CCO)c1ccc(C(O)CC)nc1 |
| InChI | InChI=1S/C13H22N2O2/c1-3-7-15(8-9-16)11-5-6-12(14-10-11)13(17)4-2/h5-6,10,13,16-17H,3-4,7-9H2,1-2H3 |
| InChIKey | SPJUDBHAPCNIHF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |