C20H20FN3O4S — CID 11258592
8-ethyl-4-(4-fluoro-3-methoxyanilino)-6-methylsulfonylquinoline-3-carboxamide (PubChem CID 11258592) has the molecular formula C20H20FN3O4S and a molecular weight of 417.46 g/mol. Its IUPAC name is 8-ethyl-4-(4-fluoro-3-methoxyanilino)-6-methylsulfonylquinoline-3-carboxamide.
| Compound Name | 8-ethyl-4-(4-fluoro-3-methoxyanilino)-6-methylsulfonylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11258592 |
| Molecular Formula | C20H20FN3O4S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 8-ethyl-4-(4-fluoro-3-methoxyanilino)-6-methylsulfonylquinoline-3-carboxamide |
| SMILES | CCc1cc(S(C)(=O)=O)cc2c(Nc3ccc(F)c(OC)c3)c(C(N)=O)cnc12 |
| InChI | InChI=1S/C20H20FN3O4S/c1-4-11-7-13(29(3,26)27)9-14-18(11)23-10-15(20(22)25)19(14)24-12-5-6-16(21)17(8-12)28-2/h5-10H,4H2,1-3H3,(H2,22,25)(H,23,24) |
| InChIKey | XYAROEAMFMJRHN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |