C9H9FN4S — CID 112586126
[4-(5-fluoro-2-pyridinyl)-5-methyl-1,3-thiazol-2-yl]hydrazine (PubChem CID 112586126) has the molecular formula C9H9FN4S and a molecular weight of 224.26 g/mol. Its IUPAC name is [4-(5-fluoro-2-pyridinyl)-5-methyl-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [4-(5-fluoro-2-pyridinyl)-5-methyl-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 112586126 |
| Molecular Formula | C9H9FN4S |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | [4-(5-fluoro-2-pyridinyl)-5-methyl-1,3-thiazol-2-yl]hydrazine |
| SMILES | Cc1sc(NN)nc1-c1ccc(F)cn1 |
| InChI | InChI=1S/C9H9FN4S/c1-5-8(13-9(14-11)15-5)7-3-2-6(10)4-12-7/h2-4H,11H2,1H3,(H,13,14) |
| InChIKey | RVYISHJKVXHJQF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|