C10H11F2NO3 — CID 112586440
2-fluoro-3-(5-fluoro-2-pyridinyl)-3-hydroxypentanoic acid (PubChem CID 112586440) has the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. Its IUPAC name is 2-fluoro-3-(5-fluoro-2-pyridinyl)-3-hydroxypentanoic acid.
| Compound Name | 2-fluoro-3-(5-fluoro-2-pyridinyl)-3-hydroxypentanoic acid |
|---|---|
| PubChem CID | 112586440 |
| Molecular Formula | C10H11F2NO3 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-fluoro-3-(5-fluoro-2-pyridinyl)-3-hydroxypentanoic acid |
| SMILES | CCC(O)(c1ccc(F)cn1)C(F)C(=O)O |
| InChI | InChI=1S/C10H11F2NO3/c1-2-10(16,8(12)9(14)15)7-4-3-6(11)5-13-7/h3-5,8,16H,2H2,1H3,(H,14,15) |
| InChIKey | QBDHBWGEWAJMIZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |