About CID 11258818
CID 11258818 (PubChem CID 11258818) has the molecular formula C18H30NOSi
and a molecular weight of 304.53 g/mol.
Molecular Properties
| Compound Name | CID 11258818 |
| PubChem CID | 11258818 |
| Molecular Formula | C18H30NOSi |
| Molecular Weight | 304.53 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)(CC)[C]1[CH][CH][CH][C]1C1=N[C@@H](C(C)(C)C)CO1 |
| InChI | InChI=1S/C18H30NOSi/c1-7-21(8-2,9-3)15-12-10-11-14(15)17-19-16(13-20-17)18(4,5)6/h10-12,16H,7-9,13H2,1-6H3/t16-/m1/s1 |
| InChIKey | ZXTRGZBMEPTIQX-MRXNPFEDSA-N |
| XLogP | 4.65 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11258818 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11258818?
The IUPAC name of CID 11258818 (CID 11258818) is not available.
What is the SMILES notation for CID 11258818?
The canonical SMILES for CID 11258818 is CC[Si](CC)(CC)[C]1[CH][CH][CH][C]1C1=N[C@@H](C(C)(C)C)CO1.
What is the InChIKey of CID 11258818?
The InChIKey is ZXTRGZBMEPTIQX-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H30NOSi/c1-7-21(8-2,9-3)15-12-10-11-14(15)17-19-16(13-20-17)18(4,5)6/h10-12,16H,7-9,13H2,1-6H3/t16-/m1/s1.
What are the key properties of CID 11258818?
CID 11258818 has a molecular weight of 304.53 g/mol, XLogP of 4.65, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11258818 is sourced from PubChem (CID 11258818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).