C26H30N6 — CID 11258863
(4S,9S,19R,24R)-3,10,18,25,31,32-hexazapentacyclo[25.3.1.112,16.04,9.019,24]dotriaconta-1(31),2,10,12(32),13,15,17,25,27,29-decaene (PubChem CID 11258863) has the molecular formula C26H30N6 and a molecular weight of 426.57 g/mol. Its IUPAC name is (4S,9S,19R,24R)-3,10,18,25,31,32-hexazapentacyclo[25.3.1.112,16.04,9.019,24]dotriaconta-1(31),2,10,12(32),13,15,17,25,27,29-decaene.
| Compound Name | (4S,9S,19R,24R)-3,10,18,25,31,32-hexazapentacyclo[25.3.1.112,16.04,9.019,24]dotriaconta-1(31),2,10,12(32),13,15,17,25,27,29-decaene |
|---|---|
| PubChem CID | 11258863 |
| Molecular Formula | C26H30N6 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | (4S,9S,19R,24R)-3,10,18,25,31,32-hexazapentacyclo[25.3.1.112,16.04,9.019,24]dotriaconta-1(31),2,10,12(32),13,15,17,25,27,29-decaene |
| SMILES | C1=N\[C@H]2CCCC[C@@H]2/N=C/c2cccc(n2)/C=N\[C@@H]2CCCC[C@H]2/N=C/c2cccc/1n2 |
| InChI | InChI=1S/C26H30N6/c1-2-12-24-23(11-1)27-15-19-7-5-9-21(31-19)17-29-25-13-3-4-14-26(25)30-18-22-10-6-8-20(32-22)16-28-24/h5-10,15-18,23-26H,1-4,11-14H2/b27-15-,28-16+,29-17+,30-18-/t23-,24-,25+,26+ |
| InChIKey | JUWUSYVZPJNZEP-MSICHYCLSA-N |
| XLogP | 4.49 |
| TPSA | 75.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |