C12H14F5NO — CID 112589351
2,3,4,5,6-pentafluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]aniline (PubChem CID 112589351) has the molecular formula C12H14F5NO and a molecular weight of 283.24 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]aniline |
|---|---|
| PubChem CID | 112589351 |
| Molecular Formula | C12H14F5NO |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]aniline |
| SMILES | CC(C)(C)OCCNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H14F5NO/c1-12(2,3)19-5-4-18-11-9(16)7(14)6(13)8(15)10(11)17/h18H,4-5H2,1-3H3 |
| InChIKey | NPSSYEJSGNQUHL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|