C13H26Cl2O — CID 112592527
3,3-bis(chloromethyl)-5-methyl-1-[(2-methylpropan-2-yl)oxy]hexane (PubChem CID 112592527) has the molecular formula C13H26Cl2O and a molecular weight of 269.26 g/mol. Its IUPAC name is 3,3-bis(chloromethyl)-5-methyl-1-[(2-methylpropan-2-yl)oxy]hexane.
| Compound Name | 3,3-bis(chloromethyl)-5-methyl-1-[(2-methylpropan-2-yl)oxy]hexane |
|---|---|
| PubChem CID | 112592527 |
| Molecular Formula | C13H26Cl2O |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3,3-bis(chloromethyl)-5-methyl-1-[(2-methylpropan-2-yl)oxy]hexane |
| SMILES | CC(C)CC(CCl)(CCl)CCOC(C)(C)C |
| InChI | InChI=1S/C13H26Cl2O/c1-11(2)8-13(9-14,10-15)6-7-16-12(3,4)5/h11H,6-10H2,1-5H3 |
| InChIKey | JMPOZRVIQWICHR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|