C8H11F5N4O — CID 112592780
[4-(2-methoxyethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 112592780) has the molecular formula C8H11F5N4O and a molecular weight of 274.19 g/mol. Its IUPAC name is [4-(2-methoxyethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-(2-methoxyethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 112592780 |
| Molecular Formula | C8H11F5N4O |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | [4-(2-methoxyethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-yl]methanamine |
| SMILES | COCCn1c(CN)nnc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H11F5N4O/c1-18-3-2-17-5(4-14)15-16-6(17)7(9,10)8(11,12)13/h2-4,14H2,1H3 |
| InChIKey | BBZMMXLOBCLIMT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|