C32H58 — CID 11259296
(4E,6Z,8Z,10E)-5,6,7,8,9,10-hexapropyltetradeca-4,6,8,10-tetraene (PubChem CID 11259296) has the molecular formula C32H58 and a molecular weight of 442.82 g/mol. Its IUPAC name is (4E,6Z,8Z,10E)-5,6,7,8,9,10-hexapropyltetradeca-4,6,8,10-tetraene.
| Compound Name | (4E,6Z,8Z,10E)-5,6,7,8,9,10-hexapropyltetradeca-4,6,8,10-tetraene |
|---|---|
| PubChem CID | 11259296 |
| Molecular Formula | C32H58 |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 442.45 |
| IUPAC Name | (4E,6Z,8Z,10E)-5,6,7,8,9,10-hexapropyltetradeca-4,6,8,10-tetraene |
| SMILES | CCC/C=C(CCC)/C(CCC)=C(CCC)\C(CCC)=C(CCC)/C(=C/CCC)CCC |
| InChI | InChI=1S/C32H58/c1-9-17-25-27(19-11-3)29(21-13-5)31(23-15-7)32(24-16-8)30(22-14-6)28(20-12-4)26-18-10-2/h25-26H,9-24H2,1-8H3/b27-25+,28-26+,31-29-,32-30- |
| InChIKey | AUXNRBGDNUCSLQ-HNQHXAAYSA-N |
| XLogP | 11.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|