About 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide
4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide (PubChem CID 11259422) has the molecular formula C23H27Cl2N3O2
and a molecular weight of 448.39 g/mol. Its IUPAC name is 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide |
| PubChem CID | 11259422 |
| Molecular Formula | C23H27Cl2N3O2 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCOCC1)c1cnc(Nc2ccc(Cl)cc2Cl)cc1C1CCCC1 |
| InChI | InChI=1S/C23H27Cl2N3O2/c24-17-5-6-21(20(25)11-17)28-22-12-18(16-3-1-2-4-16)19(14-26-22)23(29)27-13-15-7-9-30-10-8-15/h5-6,11-12,14-16H,1-4,7-10,13H2,(H,26,28)(H,27,29) |
| InChIKey | SCUGHUNYELWZGT-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide?
The IUPAC name of 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide (CID 11259422) is 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide.
What is the SMILES notation for 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide?
The canonical SMILES for 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide is O=C(NCC1CCOCC1)c1cnc(Nc2ccc(Cl)cc2Cl)cc1C1CCCC1.
What is the InChIKey of 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide?
The InChIKey is SCUGHUNYELWZGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27Cl2N3O2/c24-17-5-6-21(20(25)11-17)28-22-12-18(16-3-1-2-4-16)19(14-26-22)23(29)27-13-15-7-9-30-10-8-15/h5-6,11-12,14-16H,1-4,7-10,13H2,(H,26,28)(H,27,29).
What are the key properties of 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide?
4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide has a molecular weight of 448.39 g/mol, XLogP of 5.95, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide is sourced from PubChem (CID 11259422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).