About 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one
5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one (PubChem CID 112594225) has the molecular formula C9H14N4O2
and a molecular weight of 210.24 g/mol. Its IUPAC name is 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one |
| PubChem CID | 112594225 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one |
| SMILES | NCC1CN(CCn2cccn2)C(=O)O1 |
| InChI | InChI=1S/C9H14N4O2/c10-6-8-7-12(9(14)15-8)4-5-13-3-1-2-11-13/h1-3,8H,4-7,10H2 |
| InChIKey | MYUFOPLSENSQPS-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one?
The IUPAC name of 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one (CID 112594225) is 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one is NCC1CN(CCn2cccn2)C(=O)O1.
What is the InChIKey of 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one?
The InChIKey is MYUFOPLSENSQPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2/c10-6-8-7-12(9(14)15-8)4-5-13-3-1-2-11-13/h1-3,8H,4-7,10H2.
What are the key properties of 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one?
5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one has a molecular weight of 210.24 g/mol, XLogP of -0.34, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-3-(2-pyrazol-1-ylethyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 112594225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).