C20H22F3N7O2 — CID 11259447
2-[6-cyano-3-[[2,2-difluoro-2-(6-methyl-2-pyridinyl)ethyl]amino]-2-fluorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide (PubChem CID 11259447) has the molecular formula C20H22F3N7O2 and a molecular weight of 449.44 g/mol. Its IUPAC name is 2-[6-cyano-3-[[2,2-difluoro-2-(6-methyl-2-pyridinyl)ethyl]amino]-2-fluorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide.
| Compound Name | 2-[6-cyano-3-[[2,2-difluoro-2-(6-methyl-2-pyridinyl)ethyl]amino]-2-fluorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide |
|---|---|
| PubChem CID | 11259447 |
| Molecular Formula | C20H22F3N7O2 |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 2-[6-cyano-3-[[2,2-difluoro-2-(6-methyl-2-pyridinyl)ethyl]amino]-2-fluorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide |
| SMILES | Cc1cccc(C(F)(F)CNc2ccc(C#N)c(CC(=O)NCCON=C(N)N)c2F)n1 |
| InChI | InChI=1S/C20H22F3N7O2/c1-12-3-2-4-16(29-12)20(22,23)11-28-15-6-5-13(10-24)14(18(15)21)9-17(31)27-7-8-32-30-19(25)26/h2-6,28H,7-9,11H2,1H3,(H,27,31)(H4,25,26,30) |
| InChIKey | LERHVOWPSNNLSL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 151.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|