3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride

C10H20ClNO3S — CID 112594679

IUPAC3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride
SMILESCCC1COC(C)CN1CCCS(=O)(=O)Cl
InChIInChI=1S/C10H20ClNO3S/c1-3-10-8-15-9(2)7-12(10)5-4-6-16(11,13)14/h9-10H,3-8H2,1-2H3
InChIKeyGKVIGEIFOWMPJH-UHFFFAOYSA-N
MW269.79 g/mol
LogP1.44
Rot. Bonds5

About 3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride

3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride (PubChem CID 112594679) has the molecular formula C10H20ClNO3S and a molecular weight of 269.79 g/mol. Its IUPAC name is 3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride.

Molecular Properties

Compound Name3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride
PubChem CID112594679
Molecular FormulaC10H20ClNO3S
Molecular Weight269.79 g/mol
Exact Mass269.09
IUPAC Name3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride
SMILESCCC1COC(C)CN1CCCS(=O)(=O)Cl
InChIInChI=1S/C10H20ClNO3S/c1-3-10-8-15-9(2)7-12(10)5-4-6-16(11,13)14/h9-10H,3-8H2,1-2H3
InChIKeyGKVIGEIFOWMPJH-UHFFFAOYSA-N
XLogP1.44
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.79
LogP ≤ 51.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride?
The IUPAC name of 3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride (CID 112594679) is 3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride.
What is the SMILES notation for 3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride?
The canonical SMILES for 3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride is CCC1COC(C)CN1CCCS(=O)(=O)Cl.
What is the InChIKey of 3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride?
The InChIKey is GKVIGEIFOWMPJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClNO3S/c1-3-10-8-15-9(2)7-12(10)5-4-6-16(11,13)14/h9-10H,3-8H2,1-2H3.
What are the key properties of 3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride?
3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride has a molecular weight of 269.79 g/mol, XLogP of 1.44, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethyl-2-methylmorpholin-4-yl)propane-1-sulfonyl chloride is sourced from PubChem (CID 112594679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).