C19H19ClN4O3S2 — CID 11259485
N-[5-chloro-2-(2-methylpiperidine-1-carbonyl)phenyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 11259485) has the molecular formula C19H19ClN4O3S2 and a molecular weight of 450.97 g/mol. Its IUPAC name is N-[5-chloro-2-(2-methylpiperidine-1-carbonyl)phenyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[5-chloro-2-(2-methylpiperidine-1-carbonyl)phenyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 11259485 |
| Molecular Formula | C19H19ClN4O3S2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N-[5-chloro-2-(2-methylpiperidine-1-carbonyl)phenyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | CC1CCCCN1C(=O)c1ccc(Cl)cc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C19H19ClN4O3S2/c1-12-5-2-3-10-24(12)19(25)14-9-8-13(20)11-16(14)23-29(26,27)17-7-4-6-15-18(17)22-28-21-15/h4,6-9,11-12,23H,2-3,5,10H2,1H3 |
| InChIKey | HFKJQZKHUWDHMH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|