About 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile
1-(2-chloroethyl)imidazole-4,5-dicarbonitrile (PubChem CID 112595041) has the molecular formula C7H5ClN4
and a molecular weight of 180.60 g/mol. Its IUPAC name is 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile |
| PubChem CID | 112595041 |
| Molecular Formula | C7H5ClN4 |
| Molecular Weight | 180.60 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(CCCl)c1C#N |
| InChI | InChI=1S/C7H5ClN4/c8-1-2-12-5-11-6(3-9)7(12)4-10/h5H,1-2H2 |
| InChIKey | VWQRBVGFDADVDC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.60 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile?
The IUPAC name of 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile (CID 112595041) is 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile?
The canonical SMILES for 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile is N#Cc1ncn(CCCl)c1C#N.
What is the InChIKey of 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile?
The InChIKey is VWQRBVGFDADVDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN4/c8-1-2-12-5-11-6(3-9)7(12)4-10/h5H,1-2H2.
What are the key properties of 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile?
1-(2-chloroethyl)imidazole-4,5-dicarbonitrile has a molecular weight of 180.60 g/mol, XLogP of 0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroethyl)imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 112595041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).