C10H11N5 — CID 112595164
1-(pyrrolidin-3-ylmethyl)imidazole-4,5-dicarbonitrile (PubChem CID 112595164) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-(pyrrolidin-3-ylmethyl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(pyrrolidin-3-ylmethyl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595164 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-(pyrrolidin-3-ylmethyl)imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(CC2CCNC2)c1C#N |
| InChI | InChI=1S/C10H11N5/c11-3-9-10(4-12)15(7-14-9)6-8-1-2-13-5-8/h7-8,13H,1-2,5-6H2 |
| InChIKey | OOKNPRCSTAMNKX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |