C12H14N6 — CID 112595359
1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile (PubChem CID 112595359) has the molecular formula C12H14N6 and a molecular weight of 242.29 g/mol. Its IUPAC name is 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595359 |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile |
| SMILES | CC(N)(C#N)CCCCn1cnc(C#N)c1C#N |
| InChI | InChI=1S/C12H14N6/c1-12(16,8-15)4-2-3-5-18-9-17-10(6-13)11(18)7-14/h9H,2-5,16H2,1H3 |
| InChIKey | SESCSABONFAYMI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|