About 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile
1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile (PubChem CID 112595359) has the molecular formula C12H14N6
and a molecular weight of 242.29 g/mol. Its IUPAC name is 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile |
| PubChem CID | 112595359 |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile |
| SMILES | CC(N)(C#N)CCCCn1cnc(C#N)c1C#N |
| InChI | InChI=1S/C12H14N6/c1-12(16,8-15)4-2-3-5-18-9-17-10(6-13)11(18)7-14/h9H,2-5,16H2,1H3 |
| InChIKey | SESCSABONFAYMI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile?
The IUPAC name of 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile (CID 112595359) is 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile?
The canonical SMILES for 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile is CC(N)(C#N)CCCCn1cnc(C#N)c1C#N.
What is the InChIKey of 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile?
The InChIKey is SESCSABONFAYMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N6/c1-12(16,8-15)4-2-3-5-18-9-17-10(6-13)11(18)7-14/h9H,2-5,16H2,1H3.
What are the key properties of 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile?
1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile has a molecular weight of 242.29 g/mol, XLogP of 1.04, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-5-cyanohexyl)imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 112595359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).