C24H33F3N2O3 — CID 11259556
[(1S,3R)-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1-propan-2-ylcyclopentyl]-[6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazin-3-yl]methanone (PubChem CID 11259556) has the molecular formula C24H33F3N2O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is [(1S,3R)-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1-propan-2-ylcyclopentyl]-[6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazin-3-yl]methanone.
| Compound Name | [(1S,3R)-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1-propan-2-ylcyclopentyl]-[6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazin-3-yl]methanone |
|---|---|
| PubChem CID | 11259556 |
| Molecular Formula | C24H33F3N2O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | [(1S,3R)-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1-propan-2-ylcyclopentyl]-[6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazin-3-yl]methanone |
| SMILES | CC(C)[C@]1(C(=O)N2COc3ccc(C(F)(F)F)cc3C2)CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 |
| InChI | InChI=1S/C24H33F3N2O3/c1-15(2)23(8-7-20(10-23)28-11-16(3)32-17(4)12-28)22(30)29-13-18-9-19(24(25,26)27)5-6-21(18)31-14-29/h5-6,9,15-17,20H,7-8,10-14H2,1-4H3/t16-,17+,20-,23+/m1/s1 |
| InChIKey | UNKXSVFWWYZLEV-UGBDLMATSA-N |
| XLogP | 4.69 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |