About 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile
1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile (PubChem CID 112595850) has the molecular formula C11H8N6
and a molecular weight of 224.23 g/mol. Its IUPAC name is 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile |
| PubChem CID | 112595850 |
| Molecular Formula | C11H8N6 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile |
| SMILES | Cc1cnc(C)c(-n2cnc(C#N)c2C#N)n1 |
| InChI | InChI=1S/C11H8N6/c1-7-5-14-8(2)11(16-7)17-6-15-9(3-12)10(17)4-13/h5-6H,1-2H3 |
| InChIKey | UBIQLQPECOXAHV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 91.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile?
The IUPAC name of 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile (CID 112595850) is 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile?
The canonical SMILES for 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile is Cc1cnc(C)c(-n2cnc(C#N)c2C#N)n1.
What is the InChIKey of 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile?
The InChIKey is UBIQLQPECOXAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N6/c1-7-5-14-8(2)11(16-7)17-6-15-9(3-12)10(17)4-13/h5-6H,1-2H3.
What are the key properties of 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile?
1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile has a molecular weight of 224.23 g/mol, XLogP of 1.02, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dimethylpyrazin-2-yl)imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 112595850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).