C13H16N4 — CID 112596248
N,4-dimethyl-5-(2-phenylcyclopropyl)-1,2,4-triazol-3-amine (PubChem CID 112596248) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is N,4-dimethyl-5-(2-phenylcyclopropyl)-1,2,4-triazol-3-amine.
| Compound Name | N,4-dimethyl-5-(2-phenylcyclopropyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112596248 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N,4-dimethyl-5-(2-phenylcyclopropyl)-1,2,4-triazol-3-amine |
| SMILES | CNc1nnc(C2CC2c2ccccc2)n1C |
| InChI | InChI=1S/C13H16N4/c1-14-13-16-15-12(17(13)2)11-8-10(11)9-6-4-3-5-7-9/h3-7,10-11H,8H2,1-2H3,(H,14,16) |
| InChIKey | YMBGHBWGEJOYOP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |