About N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine
N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine (PubChem CID 112596425) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine.
Analyze N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine?
The IUPAC name of N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine (CID 112596425) is N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine.
What is the SMILES notation for N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine?
The canonical SMILES for N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine is CNc1nnc(CCC(C)C)n1C.
What is the InChIKey of N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine?
The InChIKey is OLFWIHVZRBYLEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-7(2)5-6-8-11-12-9(10-3)13(8)4/h7H,5-6H2,1-4H3,(H,10,12).
What are the key properties of N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine?
N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine has a molecular weight of 182.27 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethyl-5-(3-methylbutyl)-1,2,4-triazol-3-amine is sourced from PubChem (CID 112596425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).