About 5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine
5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine (PubChem CID 112596487) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is 5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine.
Analyze 5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine?
The IUPAC name of 5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine (CID 112596487) is 5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine?
The canonical SMILES for 5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine is CNc1nnc(CCOC)n1C.
What is the InChIKey of 5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine?
The InChIKey is FVAHZAILBAYNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O/c1-8-7-10-9-6(11(7)2)4-5-12-3/h4-5H2,1-3H3,(H,8,10).
What are the key properties of 5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine?
5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine has a molecular weight of 170.22 g/mol, XLogP of 0.05, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methoxyethyl)-N,4-dimethyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 112596487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).