C8H16N4O — CID 112596633
5-ethoxy-N,4-diethyl-1,2,4-triazol-3-amine (PubChem CID 112596633) has the molecular formula C8H16N4O and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-ethoxy-N,4-diethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-ethoxy-N,4-diethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112596633 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 5-ethoxy-N,4-diethyl-1,2,4-triazol-3-amine |
| SMILES | CCNc1nnc(OCC)n1CC |
| InChI | InChI=1S/C8H16N4O/c1-4-9-7-10-11-8(13-6-3)12(7)5-2/h4-6H2,1-3H3,(H,9,10) |
| InChIKey | DWBVQSJKNUMQFL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |