C7H14N4O — CID 112596951
N,4-diethyl-5-methoxy-1,2,4-triazol-3-amine (PubChem CID 112596951) has the molecular formula C7H14N4O and a molecular weight of 170.22 g/mol. Its IUPAC name is N,4-diethyl-5-methoxy-1,2,4-triazol-3-amine.
| Compound Name | N,4-diethyl-5-methoxy-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112596951 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | N,4-diethyl-5-methoxy-1,2,4-triazol-3-amine |
| SMILES | CCNc1nnc(OC)n1CC |
| InChI | InChI=1S/C7H14N4O/c1-4-8-6-9-10-7(12-3)11(6)5-2/h4-5H2,1-3H3,(H,8,9) |
| InChIKey | MNXQRTKKTBNRKU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |