C11H15N5 — CID 112597117
5-[(2-aminophenyl)methyl]-N,4-dimethyl-1,2,4-triazol-3-amine (PubChem CID 112597117) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 5-[(2-aminophenyl)methyl]-N,4-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-[(2-aminophenyl)methyl]-N,4-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112597117 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 5-[(2-aminophenyl)methyl]-N,4-dimethyl-1,2,4-triazol-3-amine |
| SMILES | CNc1nnc(Cc2ccccc2N)n1C |
| InChI | InChI=1S/C11H15N5/c1-13-11-15-14-10(16(11)2)7-8-5-3-4-6-9(8)12/h3-6H,7,12H2,1-2H3,(H,13,15) |
| InChIKey | RVRDELTXLWGACJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|