C9H19N5 — CID 112597131
5-(2-aminopentyl)-N,4-dimethyl-1,2,4-triazol-3-amine (PubChem CID 112597131) has the molecular formula C9H19N5 and a molecular weight of 197.29 g/mol. Its IUPAC name is 5-(2-aminopentyl)-N,4-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(2-aminopentyl)-N,4-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112597131 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 5-(2-aminopentyl)-N,4-dimethyl-1,2,4-triazol-3-amine |
| SMILES | CCCC(N)Cc1nnc(NC)n1C |
| InChI | InChI=1S/C9H19N5/c1-4-5-7(10)6-8-12-13-9(11-2)14(8)3/h7H,4-6,10H2,1-3H3,(H,11,13) |
| InChIKey | PCCJZTDMJASQQJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |