C8H15N5 — CID 112597183
5-(1-aminobut-3-enyl)-N,4-dimethyl-1,2,4-triazol-3-amine (PubChem CID 112597183) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-(1-aminobut-3-enyl)-N,4-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(1-aminobut-3-enyl)-N,4-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112597183 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 5-(1-aminobut-3-enyl)-N,4-dimethyl-1,2,4-triazol-3-amine |
| SMILES | C=CCC(N)c1nnc(NC)n1C |
| InChI | InChI=1S/C8H15N5/c1-4-5-6(9)7-11-12-8(10-2)13(7)3/h4,6H,1,5,9H2,2-3H3,(H,10,12) |
| InChIKey | ZKVYBSNJJZITEV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|