C10H21N5 — CID 112597231
N,4-dimethyl-5-[3-(propan-2-ylamino)propyl]-1,2,4-triazol-3-amine (PubChem CID 112597231) has the molecular formula C10H21N5 and a molecular weight of 211.31 g/mol. Its IUPAC name is N,4-dimethyl-5-[3-(propan-2-ylamino)propyl]-1,2,4-triazol-3-amine.
| Compound Name | N,4-dimethyl-5-[3-(propan-2-ylamino)propyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112597231 |
| Molecular Formula | C10H21N5 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | N,4-dimethyl-5-[3-(propan-2-ylamino)propyl]-1,2,4-triazol-3-amine |
| SMILES | CNc1nnc(CCCNC(C)C)n1C |
| InChI | InChI=1S/C10H21N5/c1-8(2)12-7-5-6-9-13-14-10(11-3)15(9)4/h8,12H,5-7H2,1-4H3,(H,11,14) |
| InChIKey | ZCDBLIJTVOGKBP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|