C21H18Cl2N4O4 — CID 11259733
(7R,11S)-7,11-bis(4-chlorophenyl)-2,4-dimethyl-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone (PubChem CID 11259733) has the molecular formula C21H18Cl2N4O4 and a molecular weight of 461.31 g/mol. Its IUPAC name is (7R,11S)-7,11-bis(4-chlorophenyl)-2,4-dimethyl-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone.
| Compound Name | (7R,11S)-7,11-bis(4-chlorophenyl)-2,4-dimethyl-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone |
|---|---|
| PubChem CID | 11259733 |
| Molecular Formula | C21H18Cl2N4O4 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | (7R,11S)-7,11-bis(4-chlorophenyl)-2,4-dimethyl-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone |
| SMILES | CN1C(=O)N(C)C(=O)C2(C1=O)[C@@H](c1ccc(Cl)cc1)NC(=O)N[C@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18Cl2N4O4/c1-26-17(28)21(18(29)27(2)20(26)31)15(11-3-7-13(22)8-4-11)24-19(30)25-16(21)12-5-9-14(23)10-6-12/h3-10,15-16H,1-2H3,(H2,24,25,30)/t15-,16+ |
| InChIKey | RPHTVESTJDZOPD-IYBDPMFKSA-N |
| XLogP | 3.13 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|