C10H19N5S — CID 112597518
N,4-diethyl-5-thiomorpholin-3-yl-1,2,4-triazol-3-amine (PubChem CID 112597518) has the molecular formula C10H19N5S and a molecular weight of 241.36 g/mol. Its IUPAC name is N,4-diethyl-5-thiomorpholin-3-yl-1,2,4-triazol-3-amine.
| Compound Name | N,4-diethyl-5-thiomorpholin-3-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112597518 |
| Molecular Formula | C10H19N5S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | N,4-diethyl-5-thiomorpholin-3-yl-1,2,4-triazol-3-amine |
| SMILES | CCNc1nnc(C2CSCCN2)n1CC |
| InChI | InChI=1S/C10H19N5S/c1-3-11-10-14-13-9(15(10)4-2)8-7-16-6-5-12-8/h8,12H,3-7H2,1-2H3,(H,11,14) |
| InChIKey | TWSUWFNLNSUZBJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |