C20H19IN2O3 — CID 11259752
8-(iodomethyl)-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 11259752) has the molecular formula C20H19IN2O3 and a molecular weight of 462.29 g/mol. Its IUPAC name is 8-(iodomethyl)-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | 8-(iodomethyl)-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 11259752 |
| Molecular Formula | C20H19IN2O3 |
| Molecular Weight | 462.29 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 8-(iodomethyl)-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | CN1c2ccccc2C(C)(C)C12C=Cc1cc([N+](=O)[O-])cc(CI)c1O2 |
| InChI | InChI=1S/C20H19IN2O3/c1-19(2)16-6-4-5-7-17(16)22(3)20(19)9-8-13-10-15(23(24)25)11-14(12-21)18(13)26-20/h4-11H,12H2,1-3H3 |
| InChIKey | HKFPEJUXSJSSDS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.29 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|