C9H13N3O4 — CID 112597940
N,N-dimethyl-2-(2,4,6-trioxo-1,3-diazinan-1-yl)propanamide (PubChem CID 112597940) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is N,N-dimethyl-2-(2,4,6-trioxo-1,3-diazinan-1-yl)propanamide.
| Compound Name | N,N-dimethyl-2-(2,4,6-trioxo-1,3-diazinan-1-yl)propanamide |
|---|---|
| PubChem CID | 112597940 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N,N-dimethyl-2-(2,4,6-trioxo-1,3-diazinan-1-yl)propanamide |
| SMILES | CC(C(=O)N(C)C)N1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C9H13N3O4/c1-5(8(15)11(2)3)12-7(14)4-6(13)10-9(12)16/h5H,4H2,1-3H3,(H,10,13,16) |
| InChIKey | RDTXAUSSKZAUFK-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|