C11H17N3O3 — CID 112598522
7-[3-(dimethylamino)propyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 112598522) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 7-[3-(dimethylamino)propyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-[3-(dimethylamino)propyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 112598522 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 7-[3-(dimethylamino)propyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | CN(C)CCCN1C(=O)NC(=O)C2(CC2)C1=O |
| InChI | InChI=1S/C11H17N3O3/c1-13(2)6-3-7-14-9(16)11(4-5-11)8(15)12-10(14)17/h3-7H2,1-2H3,(H,12,15,17) |
| InChIKey | ROSMFCLZCSIMEO-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|