C18H17ClF5N5O2 — CID 11259853
4-[4-[5-chloro-7-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenoxy]butan-1-ol (PubChem CID 11259853) has the molecular formula C18H17ClF5N5O2 and a molecular weight of 465.81 g/mol. Its IUPAC name is 4-[4-[5-chloro-7-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenoxy]butan-1-ol.
| Compound Name | 4-[4-[5-chloro-7-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenoxy]butan-1-ol |
|---|---|
| PubChem CID | 11259853 |
| Molecular Formula | C18H17ClF5N5O2 |
| Molecular Weight | 465.81 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 4-[4-[5-chloro-7-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenoxy]butan-1-ol |
| SMILES | C[C@H](Nc1c(-c2c(F)cc(OCCCCO)cc2F)c(Cl)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C18H17ClF5N5O2/c1-9(18(22,23)24)27-16-14(15(19)28-17-25-8-26-29(16)17)13-11(20)6-10(7-12(13)21)31-5-3-2-4-30/h6-9,27,30H,2-5H2,1H3/t9-/m0/s1 |
| InChIKey | NSIRLJFAZOCMEI-VIFPVBQESA-N |
| XLogP | 4.24 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.81 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|