C11H17N3O4 — CID 112599352
N-[2-(2,4,6-trioxo-5-propan-2-yl-1,3-diazinan-1-yl)ethyl]acetamide (PubChem CID 112599352) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is N-[2-(2,4,6-trioxo-5-propan-2-yl-1,3-diazinan-1-yl)ethyl]acetamide.
| Compound Name | N-[2-(2,4,6-trioxo-5-propan-2-yl-1,3-diazinan-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 112599352 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | N-[2-(2,4,6-trioxo-5-propan-2-yl-1,3-diazinan-1-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCN1C(=O)NC(=O)C(C(C)C)C1=O |
| InChI | InChI=1S/C11H17N3O4/c1-6(2)8-9(16)13-11(18)14(10(8)17)5-4-12-7(3)15/h6,8H,4-5H2,1-3H3,(H,12,15)(H,13,16,18) |
| InChIKey | QXMUKMSQROUYKO-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|